CAS 616-86-4 appears in our catalog under these names: 4-Ethoxy-2-nitroaniline, 95%, 4-ETHOXY-2-NITROANILINE, 97%, 97%, 4-Ethoxy-2-nitro-phenylamine, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg, 10g, 100g.
4-ethoxy-2-nitroaniline (CAS 616-86-4) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 4-ethoxy-2-nitroaniline. InChIKey: ISFYBUAVOZFROB-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 4-ethoxy-2-nitroaniline |
| InChIKey | ISFYBUAVOZFROB-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)