CAS 61642-89-5 appears in our catalog under these names: Atractylodinol, Atractylodinol, 99.60%. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 250mg, 100mg, 25 mg, 5 mg, 10 mg, 1 mg.
(2E,8E)-9-(furan-2-yl)nona-2,8-dien-4,6-diyn-1-ol (CAS 61642-89-5) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: (2E,8E)-9-(furan-2-yl)nona-2,8-dien-4,6-diyn-1-ol. InChIKey: JPWHLNBWBPJJJN-PDTNFJSOSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (2E,8E)-9-(furan-2-yl)nona-2,8-dien-4,6-diyn-1-ol |
| InChIKey | JPWHLNBWBPJJJN-PDTNFJSOSA-N |
| SMILES | C1=COC(=C1)/C=C/C#CC#C/C=C/CO |
Computed by PubChem (NCBI)