CAS 61655-97-8 appears in our catalog under these names: 2,4-Dichloro-6-methylacetanilide, 95%, 2,4-Dichloro-6-methylacetanilide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g.
N-(2,4-dichloro-6-methylphenyl)acetamide (CAS 61655-97-8) is a chemical compound with the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. IUPAC name: N-(2,4-dichloro-6-methylphenyl)acetamide. InChIKey: RLYJHSPRTRAQFE-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | N-(2,4-dichloro-6-methylphenyl)acetamide |
| InChIKey | RLYJHSPRTRAQFE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1NC(=O)C)Cl)Cl |
Computed by PubChem (NCBI)