Products 619323-15-8
CAS 619323-15-8 appears in our catalog under these names: 2-(3,4-Dibromophenyl)acetic acid, 2-(3,4-Dibromophenyl)acetic acid, 98%, 98%, 3,4-Dibromobenzeneacetic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 500mg, 1g.
2-(3,4-dibromophenyl)acetic acid (CAS 619323-15-8) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: 2-(3,4-dibromophenyl)acetic acid. InChIKey: SARHWCIVOIXKHS-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | 2-(3,4-dibromophenyl)acetic acid |
| InChIKey | SARHWCIVOIXKHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)Br)Br |
Computed by PubChem (NCBI)