CAS 61948-59-2 appears in our catalog under these names: 2,4–Dichloro–5–methoxyquinazoline, 2,4-Dichloro-5-methoxyquinazoline 97%, 2,4-Dichloro-5-methoxyquinazoline, 97%, 97%, 2,4-Dichloro-5-methoxyquinazoline, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g.
2,4-dichloro-5-methoxyquinazoline (CAS 61948-59-2) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 2,4-dichloro-5-methoxyquinazoline. InChIKey: CVILQLUABMGXTG-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2,4-dichloro-5-methoxyquinazoline |
| InChIKey | CVILQLUABMGXTG-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)