Products 620932-02-7
CAS 620932-02-7 is the registry number for ALDH1A1 modulator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
Propan-2-yl 2-(7-methyl-2,3-dioxoindol-1-yl)acetate (CAS 620932-02-7) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: propan-2-yl 2-(7-methyl-2,3-dioxoindol-1-yl)acetate. InChIKey: UFBAHEPHZWBRSO-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | propan-2-yl 2-(7-methyl-2,3-dioxoindol-1-yl)acetate |
| InChIKey | UFBAHEPHZWBRSO-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)C(=O)N2CC(=O)OC(C)C |
Computed by PubChem (NCBI)