CAS 62134-52-5 appears in our catalog under these names: 4-[(3-Acetylphenyl)amino]-4-oxobutanoic acid, 95%, 4-((3-Acetylphenyl)amino)-4-oxobutanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(3-acetylanilino)-4-oxobutanoic acid (CAS 62134-52-5) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: 4-(3-acetylanilino)-4-oxobutanoic acid. InChIKey: NORCWPAHFOSSOP-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 4-(3-acetylanilino)-4-oxobutanoic acid |
| InChIKey | NORCWPAHFOSSOP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)