CAS 62140-78-7 appears in our catalog under these names: 7-Nitro-2,3-dihydro-benzo[1,4]dioxin-6-ylamine, 95%, 7-Nitro-2,3-dihydro-1,4-benzodioxin-6-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 5g, 100mg.
6-nitro-2,3-dihydro-1,4-benzodioxin-7-amine (CAS 62140-78-7) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 6-nitro-2,3-dihydro-1,4-benzodioxin-7-amine. InChIKey: FPLCYUDKBMTETP-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 6-nitro-2,3-dihydro-1,4-benzodioxin-7-amine |
| InChIKey | FPLCYUDKBMTETP-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)