CAS 6219-53-0 appears in our catalog under these names: 3-(3-Nitrophenyl)-1H-1,2,4-triazole, 95%, 3-(3-Nitrophenyl)-1H-1,2,4-triazole, 5-(3-Nitrophenyl)-1H-1,2,4-triazole, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 2,5g, 250mg, 100mg, 1g.
5-(3-nitrophenyl)-1H-1,2,4-triazole (CAS 6219-53-0) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 5-(3-nitrophenyl)-1H-1,2,4-triazole. InChIKey: STXJRVLVLGGYPJ-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 5-(3-nitrophenyl)-1H-1,2,4-triazole |
| InChIKey | STXJRVLVLGGYPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NC=NN2 |
Computed by PubChem (NCBI)