CAS 6219-55-2 appears in our catalog under these names: 1-(4-Nitrophenyl)-1H-1,2,4-triazole, 95+%, 95+%, 1-(4-Nitrophenyl)-1H-1,2,4-triazole, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1-(4-nitrophenyl)-1,2,4-triazole (CAS 6219-55-2) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 1-(4-nitrophenyl)-1,2,4-triazole. InChIKey: YGFKLGQEQNGWOB-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-1,2,4-triazole |
| InChIKey | YGFKLGQEQNGWOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=NC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)