CAS 622-16-2 is the registry number for N,N'-methanediylidenedianiline. Offered by: Chemat Brand. Available pack sizes: on request.
N,N'-diphenylmethanediimine (CAS 622-16-2) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: N,N'-diphenylmethanediimine. InChIKey: CMESPBFFDMPSIY-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | N,N'-diphenylmethanediimine |
| InChIKey | CMESPBFFDMPSIY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=C=NC2=CC=CC=C2 |
Computed by PubChem (NCBI)