Products 62298-46-8
CAS 62298-46-8 is the registry number for 3,5-Dichloro-N-ethyl-2-hydroxy-benzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,5-dichloro-N-ethyl-2-hydroxybenzamide (CAS 62298-46-8) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: 3,5-dichloro-N-ethyl-2-hydroxybenzamide. InChIKey: IESNQJZHSXRMEX-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 3,5-dichloro-N-ethyl-2-hydroxybenzamide |
| InChIKey | IESNQJZHSXRMEX-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=C(C(=CC(=C1)Cl)Cl)O |
Computed by PubChem (NCBI)