CAS 62473-95-4 is the registry number for 6-Methoxybenzo(D)isothiazol-3(2H)-one 1,1-dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-methoxy-1,1-dioxo-1,2-benzothiazol-3-one (CAS 62473-95-4) is a chemical compound with the molecular formula C8H7NO4S and a molecular weight of 213.21 g/mol. IUPAC name: 6-methoxy-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: FGWXGHBHIOINCJ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4S |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 6-methoxy-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | FGWXGHBHIOINCJ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)NS2(=O)=O |
Computed by PubChem (NCBI)