CAS 62508-75-2 is the registry number for 3-(3-Chlorophenyl)-1,2,4-oxadiazol-5-amine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-(3-chlorophenyl)-1,2,4-oxadiazol-5-amine (CAS 62508-75-2) is a chemical compound with the molecular formula C8H6ClN3O and a molecular weight of 195.60 g/mol. IUPAC name: 3-(3-chlorophenyl)-1,2,4-oxadiazol-5-amine. InChIKey: KGKNMVLIWHRBGK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-1,2,4-oxadiazol-5-amine |
| InChIKey | KGKNMVLIWHRBGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NOC(=N2)N |
Computed by PubChem (NCBI)