CAS 6277-38-9 appears in our catalog under these names: 1-(4-Methoxy-3-nitrophenyl)ethanone, 97%, 4'–Methoxy–3'–nitroacetophenone, 4'-Methoxy-3'-nitroacetophenone, >98.0%(GC), 3'-Nitro-4'-methoxyacetophenone, 1-(4-Methoxy-3-nitrophenyl)ethanone 98%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 2g, 1000g, 50g.
1-(4-methoxy-3-nitrophenyl)ethanone (CAS 6277-38-9) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 1-(4-methoxy-3-nitrophenyl)ethanone. InChIKey: VXLKYQQBEPCMJE-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 1-(4-methoxy-3-nitrophenyl)ethanone |
| InChIKey | VXLKYQQBEPCMJE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)