Products 62847-50-1
CAS 62847-50-1 appears in our catalog under these names: 4-Bromo-5-phenyl-1,2-oxazol-3-amine, 95%, 4-Bromo-5-phenyl-1,2-oxazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-bromo-5-phenyl-1,2-oxazol-3-amine (CAS 62847-50-1) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 4-bromo-5-phenyl-1,2-oxazol-3-amine. InChIKey: SKMYIFOUGLCRPK-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 4-bromo-5-phenyl-1,2-oxazol-3-amine |
| InChIKey | SKMYIFOUGLCRPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=NO2)N)Br |
Computed by PubChem (NCBI)