Products 6286-64-2
CAS 6286-64-2 appears in our catalog under these names: 5,6-Dimethoxyindolin-2-one, 97%, 5,6-Dimethoxy-1,3-dihydroindol-2-one, 97%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g.
5,6-dimethoxy-1,3-dihydroindol-2-one (CAS 6286-64-2) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 5,6-dimethoxy-1,3-dihydroindol-2-one. InChIKey: YUVNTBICDDRBFP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 5,6-dimethoxy-1,3-dihydroindol-2-one |
| InChIKey | YUVNTBICDDRBFP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CC(=O)N2)OC |
Computed by PubChem (NCBI)
Synonyms:
5,6-dimethoxyindolin-2-one, 5,6-dimethoxy-1,3-dihydroindol-2-one, 5,6-dimethoxy-2,3-dihydro-1H-indol-2-one, 5,6-dimethoxy-1,3-dihydro-indol-2-one, 5,6-dimethoxy-2-indolinone, 2H-Indol-2-one, 1,3-dihydro-5,6-dimethoxy-, 5,6-dimethoxyoxindole, 5,6-dimethoxy oxindole, Maybridge3_006406, 5,6-dimethoxy-2-oxindole