CAS 62909-66-4 appears in our catalog under these names: 4-Amino-3,5-dichlorobenzaldehyde, 4-Amino-3,5-dichlorobenzaldehyde, 98%, 4-Amino-3,5-dichlorobenzaldehyde, 98%, 98%, Clenbuterol EP Impurity A, Clenbuterol Impurity A 98%. Offered by: TRC, Fluorochem, Chemat, Chemat Brand, Ambeed. Available pack sizes: 1g, 100mg, 250mg, on request, 5g.
4-amino-3,5-dichlorobenzaldehyde (CAS 62909-66-4) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: 4-amino-3,5-dichlorobenzaldehyde. InChIKey: LDCXVGKWQBEJRH-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | 4-amino-3,5-dichlorobenzaldehyde |
| InChIKey | LDCXVGKWQBEJRH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N)Cl)C=O |
Computed by PubChem (NCBI)