CAS 62919-60-2 is the registry number for 2-Chloro-1-(2,4,5-trimethylphenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-chloro-1-(2,4,5-trimethylphenyl)ethanone (CAS 62919-60-2) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 2-chloro-1-(2,4,5-trimethylphenyl)ethanone. InChIKey: UCFWNQZOCNAHQD-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 2-chloro-1-(2,4,5-trimethylphenyl)ethanone |
| InChIKey | UCFWNQZOCNAHQD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)C(=O)CCl)C |
Computed by PubChem (NCBI)