CAS 6296-89-5 appears in our catalog under these names: Methyl 4–hydrazinylbenzoate hydrochloride, Methyl 4-hydrazinylbenzoate hydrochloride 97%, Methyl 4-hydrazinylbenzoate hydrochloride, 97%, 97%, methyl 4-hydrazinobenzoate hydrochloride, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 250mg.
Methyl 4-hydrazinylbenzoate;hydrochloride (CAS 6296-89-5) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: methyl 4-hydrazinylbenzoate;hydrochloride. InChIKey: MXSGRGCOQOKOEH-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | methyl 4-hydrazinylbenzoate;hydrochloride |
| InChIKey | MXSGRGCOQOKOEH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)NN.Cl |
Computed by PubChem (NCBI)