CAS 6300-95-4 appears in our catalog under these names: 6-phenyldihydropyrimidine-2,4(1H,3H)-dione, 95%, 6-Phenyldihydropyrimidine-2,4(1h,3h)-dione, 97%, 6-Phenyldihydropyrimidine-2,4(1h,3h)-dione/ 99.97% (existing batch purity), 6-Phenyl-1,3-diazinane-2,4-dione, 6-Phenyldihydropyrimidine-2,4(1h,3h)-dione. Offered by: Fluorochem, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 50mg, 100mg, 5g, 1mg, 5mg, 10mg, 25mg, 200mg.
6-phenyl-1,3-diazinane-2,4-dione (CAS 6300-95-4) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 6-phenyl-1,3-diazinane-2,4-dione. InChIKey: GTYVCYXIFVPPIP-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 6-phenyl-1,3-diazinane-2,4-dione |
| InChIKey | GTYVCYXIFVPPIP-UHFFFAOYSA-N |
| SMILES | C1C(NC(=O)NC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)