CAS 63001-36-5 is the registry number for 3,4-Dichloro-5-hydroxybenzoic acid 98%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
3,4-dichloro-5-hydroxybenzoic acid (CAS 63001-36-5) is a chemical compound with the molecular formula C7H4Cl2O3 and a molecular weight of 207.01 g/mol. IUPAC name: 3,4-dichloro-5-hydroxybenzoic acid. InChIKey: LVFSEVVQHBJLQX-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2O3 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 3,4-dichloro-5-hydroxybenzoic acid |
| InChIKey | LVFSEVVQHBJLQX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)