CAS 63020-59-7 is the registry number for 4-Methoxychrysene. Offered by: TRC. Available pack sizes: 25mg.
4-methoxychrysene (CAS 63020-59-7) is a chemical compound with the molecular formula C19H14O and a molecular weight of 258.3 g/mol. IUPAC name: 4-methoxychrysene. InChIKey: BLCMPZSCVBKWEY-UHFFFAOYSA-N.
| Molecular formula | C19H14O |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 4-methoxychrysene |
| InChIKey | BLCMPZSCVBKWEY-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C3=C(C=C2)C4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)