CAS 98655-16-4 is the registry number for 2-Phenyl-2,3-dihydro-1H-cyclopenta[a]naphthalen-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-phenyl-2,3-dihydrocyclopenta[a]naphthalen-1-one (CAS 98655-16-4) is a chemical compound with the molecular formula C19H14O and a molecular weight of 258.3 g/mol. IUPAC name: 2-phenyl-2,3-dihydrocyclopenta[a]naphthalen-1-one. InChIKey: IZVMNGHVRKMQJT-UHFFFAOYSA-N.
| Molecular formula | C19H14O |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 2-phenyl-2,3-dihydrocyclopenta[a]naphthalen-1-one |
| InChIKey | IZVMNGHVRKMQJT-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)C2=C1C=CC3=CC=CC=C32)C4=CC=CC=C4 |
Computed by PubChem (NCBI)