CAS 24253-48-3 is the registry number for 2-Methoxytriphenylene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2-methoxytriphenylene (CAS 24253-48-3) is a chemical compound with the molecular formula C19H14O and a molecular weight of 258.3 g/mol. IUPAC name: 2-methoxytriphenylene. InChIKey: FSDKJDNCWXNBAZ-UHFFFAOYSA-N.
| Molecular formula | C19H14O |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 2-methoxytriphenylene |
| InChIKey | FSDKJDNCWXNBAZ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=CC=CC=C3C4=CC=CC=C42 |
Computed by PubChem (NCBI)