CAS 63020-58-6 is the registry number for 2-Methoxychrysene, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg.
2-methoxychrysene (CAS 63020-58-6) is a chemical compound with the molecular formula C19H14O and a molecular weight of 258.3 g/mol. IUPAC name: 2-methoxychrysene. InChIKey: LYDLBBJVMRYAFH-UHFFFAOYSA-N.
| Molecular formula | C19H14O |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 2-methoxychrysene |
| InChIKey | LYDLBBJVMRYAFH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C(C=C2)C4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)