CAS 25603-67-2 appears in our catalog under these names: 9–Phenyl–9–fluorenol, 9-Phenyl-9-fluorenol, >98.0%(HPLC), 9-Phenyl-9H-fluoren-9-ol 98%, 9-Phenyl-9H-fluoren-9-ol, 98%, 98%, 9-Phenyl-9H-fluoren-9-ol, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g.
9-phenylfluoren-9-ol (CAS 25603-67-2) is a chemical compound with the molecular formula C19H14O and a molecular weight of 258.3 g/mol. IUPAC name: 9-phenylfluoren-9-ol. InChIKey: UJPHBDAPVWFPTG-UHFFFAOYSA-N.
| Molecular formula | C19H14O |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 9-phenylfluoren-9-ol |
| InChIKey | UJPHBDAPVWFPTG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=CC=CC=C3C4=CC=CC=C42)O |
Computed by PubChem (NCBI)