CAS 4657-89-0 is the registry number for 1,2-Dihydroacenaphthylen-5-yl(phenyl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1,2-dihydroacenaphthylen-5-yl(phenyl)methanone (CAS 4657-89-0) is a chemical compound with the molecular formula C19H14O and a molecular weight of 258.3 g/mol. IUPAC name: 1,2-dihydroacenaphthylen-5-yl(phenyl)methanone. InChIKey: YQRRSORFUCNQAC-UHFFFAOYSA-N.
| Molecular formula | C19H14O |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 1,2-dihydroacenaphthylen-5-yl(phenyl)methanone |
| InChIKey | YQRRSORFUCNQAC-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=C(C3=CC=CC1=C23)C(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)