CAS 69847-25-2 is the registry number for 3-Methoxybenz(a)anthracene. Offered by: TRC. Available pack sizes: 100mg, 10mg.
3-methoxybenzo[a]anthracene (CAS 69847-25-2) is a chemical compound with the molecular formula C19H14O and a molecular weight of 258.3 g/mol. IUPAC name: 3-methoxybenzo[a]anthracene. InChIKey: FDVWSUSGAVPIMR-UHFFFAOYSA-N.
| Molecular formula | C19H14O |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 3-methoxybenzo[a]anthracene |
| InChIKey | FDVWSUSGAVPIMR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=CC4=CC=CC=C4C=C3C=C2 |
Computed by PubChem (NCBI)