Products 63028-31-9

CAS 63028-31-9 is the registry number for 4-(2,5-Dichlorophenyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

4-(2,5-dichlorophenyl)benzoic acid (CAS 63028-31-9) is a chemical compound with the molecular formula C13H8Cl2O2 and a molecular weight of 267.10 g/mol. IUPAC name: 4-(2,5-dichlorophenyl)benzoic acid. InChIKey: XAKPMSIGBXHCRV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8Cl2O2
Molecular weight267.10 g/mol
IUPAC name4-(2,5-dichlorophenyl)benzoic acid
InChIKeyXAKPMSIGBXHCRV-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=C(C=CC(=C2)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)