CAS 630392-25-5 is the registry number for 4-(3,5-Dimethylisoxazol-4-yl)benzaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(3,5-dimethyl-1,2-oxazol-4-yl)benzaldehyde (CAS 630392-25-5) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 4-(3,5-dimethyl-1,2-oxazol-4-yl)benzaldehyde. InChIKey: FIQNXMIUHQZTDY-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 4-(3,5-dimethyl-1,2-oxazol-4-yl)benzaldehyde |
| InChIKey | FIQNXMIUHQZTDY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)