Products 6306-53-2

CAS 6306-53-2 is the registry number for (αR)-1,3-Dihydro-α-(1-methylethyl)-1,3-dioxo-2H-isoindole-2-acetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

(2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid (CAS 6306-53-2) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid. InChIKey: UUIPGCXIZVZSEC-SNVBAGLBSA-N.

Identity
Molecular formulaC13H13NO4
Molecular weight247.25 g/mol
IUPAC name(2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid
InChIKeyUUIPGCXIZVZSEC-SNVBAGLBSA-N
SMILESCC(C)[C@H](C(=O)O)N1C(=O)C2=CC=CC=C2C1=O

Computed by PubChem (NCBI)