CAS 6306-53-2 is the registry number for (αR)-1,3-Dihydro-α-(1-methylethyl)-1,3-dioxo-2H-isoindole-2-acetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
(2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid (CAS 6306-53-2) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid. InChIKey: UUIPGCXIZVZSEC-SNVBAGLBSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoic acid |
| InChIKey | UUIPGCXIZVZSEC-SNVBAGLBSA-N |
| SMILES | CC(C)[C@H](C(=O)O)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)