Products 6312-53-4
CAS 6312-53-4 is the registry number for 5-Hydroxy-2,3-dihydronaphthalene-1,4-dione. Offered by: Biosynth. Available pack sizes: 0,005g, 25g, 50g, 100g.
5-hydroxy-2,3-dihydronaphthalene-1,4-dione (CAS 6312-53-4) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: 5-hydroxy-2,3-dihydronaphthalene-1,4-dione. InChIKey: VYTBDSUNRJYVHL-UHFFFAOYSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 5-hydroxy-2,3-dihydronaphthalene-1,4-dione |
| InChIKey | VYTBDSUNRJYVHL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C1=O)C=CC=C2O |
Computed by PubChem (NCBI)