Products 6317-49-3
CAS 6317-49-3 appears in our catalog under these names: Diethyl 4-oxopimelate, Diethyl 4–oxopimelate, 4-Diethyloxopimelate, Diethyl 4-oxoheptanedioate 98%, DIETHYL 4-OXOPIMELATE, 98%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 100mg, 250mg, 500mg, 100g, 25g, 500g, 0,1kg, 0,05kg.
Diethyl 4-oxoheptanedioate (CAS 6317-49-3) is a chemical compound with the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. IUPAC name: diethyl 4-oxoheptanedioate. InChIKey: ZGBUXZJMZBBISR-UHFFFAOYSA-N.
| Molecular formula | C11H18O5 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | diethyl 4-oxoheptanedioate |
| InChIKey | ZGBUXZJMZBBISR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(=O)CCC(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
Diethyl 4-oxoheptanedioate, Heptanedioic acid, 4-oxo-, diethyl ester, Diethyl 4-oxopimelate, 1,7-diethyl 4-oxoheptanedioate, Diethyl .gamma.-ketopimelate, Diethyl 4-ketopimelate, 4-Oxopimelic acid diethyl ester, diethyl4-oxoheptanedioate, 4-oxoheptanedioc acid diethyl ester, 4-Diethyloxopimelate