CAS 6317-89-1 appears in our catalog under these names: 3'-Acetoxyacetanilide, >95% (HPLC), 3–Acetamidophenyl acetate. Offered by: TRC, GLPBio. Available pack sizes: 25mg, 100mg, 1g, 250mg.
(3-acetamidophenyl) acetate (CAS 6317-89-1) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: (3-acetamidophenyl) acetate. InChIKey: ONWKGGFEPJUBHK-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (3-acetamidophenyl) acetate |
| InChIKey | ONWKGGFEPJUBHK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=CC=C1)OC(=O)C |
Computed by PubChem (NCBI)