CAS 6322-56-1 appears in our catalog under these names: 4-Hydroxy-3-Nitroacetophenone , 4′–Hydroxy–3′–nitroacetophenone, 4'-Hydroxy-3'-nitroacetophenone, 4'-Hydroxy-3'-nitroacetophenone, >98.0%(GC), 4'-Hydroxy-3'-nitroacetophenone 98%. Offered by: Chemat Brand, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: on request, 100g, 250g, 0,25kg, 5g, 0,5kg, 1kg, 5kg.
1-(4-hydroxy-3-nitrophenyl)ethanone (CAS 6322-56-1) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 1-(4-hydroxy-3-nitrophenyl)ethanone. InChIKey: MMNKVWGVSHRIJL-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 1-(4-hydroxy-3-nitrophenyl)ethanone |
| InChIKey | MMNKVWGVSHRIJL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)