CAS 63386-61-8 appears in our catalog under these names: Aripiprazole Impurity 6, Aripiprazole Impurity 28, 1-(2,6-Dichlorophenyl)piperazine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 1g, 2,5g, 250mg.
1-(2,6-dichlorophenyl)piperazine (CAS 63386-61-8) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: 1-(2,6-dichlorophenyl)piperazine. InChIKey: JIJMTXRHRBBARH-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | 1-(2,6-dichlorophenyl)piperazine |
| InChIKey | JIJMTXRHRBBARH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)