Products 63483-95-4
CAS 63483-95-4 appears in our catalog under these names: Procaterol Impurity 16, Procaterol Impurity 20, Procaterol Impurity 14, Procaterol Impurity 8. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-(2-amino-1-hydroxybutyl)-8-hydroxy-1H-quinolin-2-one (CAS 63483-95-4) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: 5-(2-amino-1-hydroxybutyl)-8-hydroxy-1H-quinolin-2-one. InChIKey: PNWVJRLGSQVYBD-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 5-(2-amino-1-hydroxybutyl)-8-hydroxy-1H-quinolin-2-one |
| InChIKey | PNWVJRLGSQVYBD-UHFFFAOYSA-N |
| SMILES | CCC(C(C1=C2C=CC(=O)NC2=C(C=C1)O)O)N |
Computed by PubChem (NCBI)