Products 63674-47-5

CAS 63674-47-5 is the registry number for 1-(3-Methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 100g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 63674-47-5) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: 1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: UFHSYKGLJVRMNV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO4
Molecular weight235.24 g/mol
IUPAC name1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyUFHSYKGLJVRMNV-UHFFFAOYSA-N
SMILESCOC1=CC=CC(=C1)N2CC(CC2=O)C(=O)O

Computed by PubChem (NCBI)