Products 637316-74-6
CAS 637316-74-6 appears in our catalog under these names: N-(3-Amino-4-chlorophenyl)butyramide, 97%, N-(3-Amino-4-chlorophenyl)butanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-(3-amino-4-chlorophenyl)butanamide (CAS 637316-74-6) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: N-(3-amino-4-chlorophenyl)butanamide. InChIKey: JKCHAPLJTLRQCQ-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | N-(3-amino-4-chlorophenyl)butanamide |
| InChIKey | JKCHAPLJTLRQCQ-UHFFFAOYSA-N |
| SMILES | CCCC(=O)NC1=CC(=C(C=C1)Cl)N |
Computed by PubChem (NCBI)