Products 638167-97-2
CAS 638167-97-2 appears in our catalog under these names: 4-(Pyridin-2-yl)butanoic acid hydrochloride, 4-(Pyridin-2-yl)butanoic acid hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 10g, 1g.
4-pyridin-2-ylbutanoic acid;hydrochloride (CAS 638167-97-2) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 4-pyridin-2-ylbutanoic acid;hydrochloride. InChIKey: AYBMHJIDLAUHPZ-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 4-pyridin-2-ylbutanoic acid;hydrochloride |
| InChIKey | AYBMHJIDLAUHPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CCCC(=O)O.Cl |
Computed by PubChem (NCBI)