CAS 63989-40-2 appears in our catalog under these names: 2-[(2-hydroxyethyl)amino]-5-nitrobenzonitrile, 95%, N-(2-Hydroxyethyl)-2-cyano-4-nitroaniline. Offered by: Combi-blocks, TCI. Available pack sizes: 5g, 1g.
2-(2-hydroxyethylamino)-5-nitrobenzonitrile (CAS 63989-40-2) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 2-(2-hydroxyethylamino)-5-nitrobenzonitrile. InChIKey: AADOGXABUHCROC-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 2-(2-hydroxyethylamino)-5-nitrobenzonitrile |
| InChIKey | AADOGXABUHCROC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C#N)NCCO |
Computed by PubChem (NCBI)