CAS 64181-76-6 is the registry number for 4'-Chloro-[1,1'-biphenyl]-2-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-chlorophenyl)phenol (CAS 64181-76-6) is a chemical compound with the molecular formula C12H9ClO and a molecular weight of 204.65 g/mol. IUPAC name: 2-(4-chlorophenyl)phenol. InChIKey: DSSULPPMTATCMP-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 2-(4-chlorophenyl)phenol |
| InChIKey | DSSULPPMTATCMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)