Products 64230-25-7
CAS 64230-25-7 is the registry number for 8-Bromo-1,2,3,5,6,7-hexahydropyrido[3,2,1-ij]quinoline, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene (CAS 64230-25-7) is a chemical compound with the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. IUPAC name: 6-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene. InChIKey: DUYPIIPRJQKGSI-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN |
|---|---|
| Molecular weight | 252.15 g/mol |
| IUPAC name | 6-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
| InChIKey | DUYPIIPRJQKGSI-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=C(C=C2)Br)CCCN3C1 |
Computed by PubChem (NCBI)