CAS 64309-02-0 is the registry number for N-(4-(4-Hydroxyphenyl)thiazol-2-yl)acetamide. Offered by: Biosynth. Available pack sizes: 10g, 1g.
N-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]acetamide (CAS 64309-02-0) is a chemical compound with the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. IUPAC name: N-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]acetamide. InChIKey: LKUWPBGOUVNUAN-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2S |
|---|---|
| Molecular weight | 234.28 g/mol |
| IUPAC name | N-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]acetamide |
| InChIKey | LKUWPBGOUVNUAN-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC(=CS1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)