Products 646528-36-1
CAS 646528-36-1 appears in our catalog under these names: 2,4-Dichloro-n-methoxy-n-methylbenzamide, 95%, 2,4-Dichloro-N-methoxy-N-methylbenzamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 250mg.
2,4-dichloro-N-methoxy-N-methylbenzamide (CAS 646528-36-1) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: 2,4-dichloro-N-methoxy-N-methylbenzamide. InChIKey: YVAUNJBXBZNYQJ-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 2,4-dichloro-N-methoxy-N-methylbenzamide |
| InChIKey | YVAUNJBXBZNYQJ-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=C(C=C(C=C1)Cl)Cl)OC |
Computed by PubChem (NCBI)