CAS 64792-56-9 is the registry number for 2-Amino-5,5-dimethyl-4,7-dihydro-5H-thieno[2,3-c]pyran-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-3-carboxylic acid (CAS 64792-56-9) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 2-amino-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-3-carboxylic acid. InChIKey: QUNNOUKRRVDLIL-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 2-amino-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-3-carboxylic acid |
| InChIKey | QUNNOUKRRVDLIL-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(CO1)SC(=C2C(=O)O)N)C |
Computed by PubChem (NCBI)