Products 648425-51-8
CAS 648425-51-8 is the registry number for 1,3,7-Trimethyl-2,6-dioxopurine-8-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg.
1,3,7-trimethyl-2,6-dioxopurine-8-carboxylic acid (CAS 648425-51-8) is a chemical compound with the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. IUPAC name: 1,3,7-trimethyl-2,6-dioxopurine-8-carboxylic acid. InChIKey: UTXISOBIQYPKSL-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O4 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 1,3,7-trimethyl-2,6-dioxopurine-8-carboxylic acid |
| InChIKey | UTXISOBIQYPKSL-UHFFFAOYSA-N |
| SMILES | CN1C2=C(N=C1C(=O)O)N(C(=O)N(C2=O)C)C |
Computed by PubChem (NCBI)