CAS 65118-17-4 is the registry number for 2–Nitro–N–(Prop–2–En–1–Yl)Benzene–1–Sulfonamide. Offered by: GLPBio. Available pack sizes: 1g, 5g.
2-nitro-N-prop-2-enylbenzenesulfonamide (CAS 65118-17-4) is a chemical compound with the molecular formula C9H10N2O4S and a molecular weight of 242.25 g/mol. IUPAC name: 2-nitro-N-prop-2-enylbenzenesulfonamide. InChIKey: MGFHJSIJOSNXPD-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4S |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | 2-nitro-N-prop-2-enylbenzenesulfonamide |
| InChIKey | MGFHJSIJOSNXPD-UHFFFAOYSA-N |
| SMILES | C=CCNS(=O)(=O)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)