CAS 6525-98-0 is the registry number for 5-(4-Bromophenyl)isoxazol-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-bromophenyl)-1,2-oxazol-3-amine (CAS 6525-98-0) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 5-(4-bromophenyl)-1,2-oxazol-3-amine. InChIKey: YINDFUSXBDZGIH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 5-(4-bromophenyl)-1,2-oxazol-3-amine |
| InChIKey | YINDFUSXBDZGIH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)N)Br |
Computed by PubChem (NCBI)